C33H42N6O — CID 58300393
4-[2-[4-[benzyl(propyl)amino]cyclohexyl]ethyl]-N,N-bis(1H-imidazol-2-ylmethyl)benzamide (PubChem CID 58300393) has the molecular formula C33H42N6O and a molecular weight of 538.74 g/mol. Its IUPAC name is 4-[2-[4-[benzyl(propyl)amino]cyclohexyl]ethyl]-N,N-bis(1H-imidazol-2-ylmethyl)benzamide.
| Compound Name | 4-[2-[4-[benzyl(propyl)amino]cyclohexyl]ethyl]-N,N-bis(1H-imidazol-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 58300393 |
| Molecular Formula | C33H42N6O |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.34 |
| IUPAC Name | 4-[2-[4-[benzyl(propyl)amino]cyclohexyl]ethyl]-N,N-bis(1H-imidazol-2-ylmethyl)benzamide |
| SMILES | CCCN(Cc1ccccc1)C1CCC(CCc2ccc(C(=O)N(Cc3ncc[nH]3)Cc3ncc[nH]3)cc2)CC1 |
| InChI | InChI=1S/C33H42N6O/c1-2-22-38(23-28-6-4-3-5-7-28)30-16-12-27(13-17-30)9-8-26-10-14-29(15-11-26)33(40)39(24-31-34-18-19-35-31)25-32-36-20-21-37-32/h3-7,10-11,14-15,18-21,27,30H,2,8-9,12-13,16-17,22-25H2,1H3,(H,34,35)(H,36,37) |
| InChIKey | LAVQRTOIRCZCEI-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |