C18H11N3O4S — CID 58302553
phenyl-(5-quinolin-8-ylsulfonyl-1,3,4-oxadiazol-2-yl)methanone (PubChem CID 58302553) has the molecular formula C18H11N3O4S and a molecular weight of 365.37 g/mol. Its IUPAC name is phenyl-(5-quinolin-8-ylsulfonyl-1,3,4-oxadiazol-2-yl)methanone.
| Compound Name | phenyl-(5-quinolin-8-ylsulfonyl-1,3,4-oxadiazol-2-yl)methanone |
|---|---|
| PubChem CID | 58302553 |
| Molecular Formula | C18H11N3O4S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | phenyl-(5-quinolin-8-ylsulfonyl-1,3,4-oxadiazol-2-yl)methanone |
| SMILES | O=C(c1ccccc1)c1nnc(S(=O)(=O)c2cccc3cccnc23)o1 |
| InChI | InChI=1S/C18H11N3O4S/c22-16(13-6-2-1-3-7-13)17-20-21-18(25-17)26(23,24)14-10-4-8-12-9-5-11-19-15(12)14/h1-11H |
| InChIKey | SHRWGCAXYNOZHM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 103.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |