C26H35F3N4O3 — CID 58305856
[(1S,4S)-4-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]-1-propan-2-ylcyclopent-2-en-1-yl]-[(1R,4R)-5-[6-(trifluoromethyl)pyrazin-2-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone (PubChem CID 58305856) has the molecular formula C26H35F3N4O3 and a molecular weight of 508.59 g/mol. Its IUPAC name is [(1S,4S)-4-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]-1-propan-2-ylcyclopent-2-en-1-yl]-[(1R,4R)-5-[6-(trifluoromethyl)pyrazin-2-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone.
| Compound Name | [(1S,4S)-4-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]-1-propan-2-ylcyclopent-2-en-1-yl]-[(1R,4R)-5-[6-(trifluoromethyl)pyrazin-2-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone |
|---|---|
| PubChem CID | 58305856 |
| Molecular Formula | C26H35F3N4O3 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | [(1S,4S)-4-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]-1-propan-2-ylcyclopent-2-en-1-yl]-[(1R,4R)-5-[6-(trifluoromethyl)pyrazin-2-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone |
| SMILES | CO[C@@H]1COCC[C@@H]1C[C@@H]1C=C[C@@](C(=O)N2C[C@H]3C[C@@H]2CN3c2cncc(C(F)(F)F)n2)(C(C)C)C1 |
| InChI | InChI=1S/C26H35F3N4O3/c1-16(2)25(6-4-17(10-25)8-18-5-7-36-15-21(18)35-3)24(34)33-14-19-9-20(33)13-32(19)23-12-30-11-22(31-23)26(27,28)29/h4,6,11-12,16-21H,5,7-10,13-15H2,1-3H3/t17-,18+,19+,20+,21+,25-/m0/s1 |
| InChIKey | GOTMTLRBAGGXLY-KHMXZZJMSA-N |
| XLogP | 3.94 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|