C18H13ClF3NO3 — CID 58306684
1-[2-(4-chlorophenoxy)ethyl]-5-(trifluoromethyl)indole-7-carboxylic acid (PubChem CID 58306684) has the molecular formula C18H13ClF3NO3 and a molecular weight of 383.75 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-5-(trifluoromethyl)indole-7-carboxylic acid.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-5-(trifluoromethyl)indole-7-carboxylic acid |
|---|---|
| PubChem CID | 58306684 |
| Molecular Formula | C18H13ClF3NO3 |
| Molecular Weight | 383.75 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-5-(trifluoromethyl)indole-7-carboxylic acid |
| SMILES | O=C(O)c1cc(C(F)(F)F)cc2ccn(CCOc3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C18H13ClF3NO3/c19-13-1-3-14(4-2-13)26-8-7-23-6-5-11-9-12(18(20,21)22)10-15(16(11)23)17(24)25/h1-6,9-10H,7-8H2,(H,24,25) |
| InChIKey | MUXRZTZFORDHLE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.75 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |