C27H32N2O4 — CID 58306854
methyl 4-[(1S)-1-[[1-(2-cyclohexyloxyethyl)indole-7-carbonyl]amino]ethyl]benzoate (PubChem CID 58306854) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is methyl 4-[(1S)-1-[[1-(2-cyclohexyloxyethyl)indole-7-carbonyl]amino]ethyl]benzoate.
| Compound Name | methyl 4-[(1S)-1-[[1-(2-cyclohexyloxyethyl)indole-7-carbonyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 58306854 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | methyl 4-[(1S)-1-[[1-(2-cyclohexyloxyethyl)indole-7-carbonyl]amino]ethyl]benzoate |
| SMILES | COC(=O)c1ccc([C@H](C)NC(=O)c2cccc3ccn(CCOC4CCCCC4)c23)cc1 |
| InChI | InChI=1S/C27H32N2O4/c1-19(20-11-13-22(14-12-20)27(31)32-2)28-26(30)24-10-6-7-21-15-16-29(25(21)24)17-18-33-23-8-4-3-5-9-23/h6-7,10-16,19,23H,3-5,8-9,17-18H2,1-2H3,(H,28,30)/t19-/m0/s1 |
| InChIKey | KBPIDEBMGGFJKT-IBGZPJMESA-N |
| XLogP | 5.27 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |