C23H17F3N2O6 — CID 58307172
N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-4-(trifluoromethoxy)benzamide (PubChem CID 58307172) has the molecular formula C23H17F3N2O6 and a molecular weight of 474.39 g/mol. Its IUPAC name is N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 58307172 |
| Molecular Formula | C23H17F3N2O6 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNC(=O)c4ccc(OC(F)(F)F)cc4)c3C2=O)C(=O)C1 |
| InChI | InChI=1S/C23H17F3N2O6/c24-23(25,26)34-15-7-4-12(5-8-15)20(31)27-11-13-2-1-3-16-19(13)22(33)28(21(16)32)17-9-6-14(29)10-18(17)30/h1-5,7-8,17H,6,9-11H2,(H,27,31) |
| InChIKey | HQUMLRPRMDEYLR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|