C22H25NO4 — CID 58307329
dimethyl 3-(4-cyclohexylanilino)benzene-1,2-dicarboxylate (PubChem CID 58307329) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is dimethyl 3-(4-cyclohexylanilino)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3-(4-cyclohexylanilino)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58307329 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | dimethyl 3-(4-cyclohexylanilino)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1cccc(Nc2ccc(C3CCCCC3)cc2)c1C(=O)OC |
| InChI | InChI=1S/C22H25NO4/c1-26-21(24)18-9-6-10-19(20(18)22(25)27-2)23-17-13-11-16(12-14-17)15-7-4-3-5-8-15/h6,9-15,23H,3-5,7-8H2,1-2H3 |
| InChIKey | QXTKUVWDJWZHDS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |