C21H25N3O5 — CID 58307896
(2S)-3-(4-hydroxyphenyl)-2-[2-[(2S)-1-(4-hydroxyphenyl)-3-oxopropan-2-yl]hydrazinyl]-N-[(2S)-1-oxopropan-2-yl]propanamide (PubChem CID 58307896) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is (2S)-3-(4-hydroxyphenyl)-2-[2-[(2S)-1-(4-hydroxyphenyl)-3-oxopropan-2-yl]hydrazinyl]-N-[(2S)-1-oxopropan-2-yl]propanamide.
| Compound Name | (2S)-3-(4-hydroxyphenyl)-2-[2-[(2S)-1-(4-hydroxyphenyl)-3-oxopropan-2-yl]hydrazinyl]-N-[(2S)-1-oxopropan-2-yl]propanamide |
|---|---|
| PubChem CID | 58307896 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (2S)-3-(4-hydroxyphenyl)-2-[2-[(2S)-1-(4-hydroxyphenyl)-3-oxopropan-2-yl]hydrazinyl]-N-[(2S)-1-oxopropan-2-yl]propanamide |
| SMILES | C[C@@H](C=O)NC(=O)[C@H](Cc1ccc(O)cc1)NN[C@H](C=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C21H25N3O5/c1-14(12-25)22-21(29)20(11-16-4-8-19(28)9-5-16)24-23-17(13-26)10-15-2-6-18(27)7-3-15/h2-9,12-14,17,20,23-24,27-28H,10-11H2,1H3,(H,22,29)/t14-,17-,20-/m0/s1 |
| InChIKey | PEUWUBXMYNHCSA-VHFSOBRXSA-N |
| XLogP | 0.62 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|