About dichloro(pyridin-3-yl)-λ3-iodane
dichloro(pyridin-3-yl)-λ3-iodane (PubChem CID 58308214) has the molecular formula C5H4Cl2IN
and a molecular weight of 275.90 g/mol. Its IUPAC name is dichloro(pyridin-3-yl)-λ3-iodane.
Molecular Properties
| Compound Name | dichloro(pyridin-3-yl)-λ3-iodane |
| PubChem CID | 58308214 |
| Molecular Formula | C5H4Cl2IN |
| Molecular Weight | 275.90 g/mol |
| Exact Mass | 274.88 |
| IUPAC Name | dichloro(pyridin-3-yl)-λ3-iodane |
| SMILES | ClI(Cl)c1cccnc1 |
| InChI | InChI=1S/C5H4Cl2IN/c6-8(7)5-2-1-3-9-4-5/h1-4H |
| InChIKey | DDJHSTMGBVNGLJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.90 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze dichloro(pyridin-3-yl)-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(pyridin-3-yl)-λ3-iodane?
The IUPAC name of dichloro(pyridin-3-yl)-λ3-iodane (CID 58308214) is dichloro(pyridin-3-yl)-λ3-iodane.
What is the SMILES notation for dichloro(pyridin-3-yl)-λ3-iodane?
The canonical SMILES for dichloro(pyridin-3-yl)-λ3-iodane is ClI(Cl)c1cccnc1.
What is the InChIKey of dichloro(pyridin-3-yl)-λ3-iodane?
The InChIKey is DDJHSTMGBVNGLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Cl2IN/c6-8(7)5-2-1-3-9-4-5/h1-4H.
What are the key properties of dichloro(pyridin-3-yl)-λ3-iodane?
dichloro(pyridin-3-yl)-λ3-iodane has a molecular weight of 275.90 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(pyridin-3-yl)-λ3-iodane is sourced from PubChem (CID 58308214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).