C18H23N3O4S — CID 58308376
4-[4-methoxy-2-methyl-3-[(1-oxothian-1-ylidene)amino]benzoyl]-2-methyl-1H-pyrazol-3-one (PubChem CID 58308376) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 4-[4-methoxy-2-methyl-3-[(1-oxothian-1-ylidene)amino]benzoyl]-2-methyl-1H-pyrazol-3-one.
| Compound Name | 4-[4-methoxy-2-methyl-3-[(1-oxothian-1-ylidene)amino]benzoyl]-2-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 58308376 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 4-[4-methoxy-2-methyl-3-[(1-oxothian-1-ylidene)amino]benzoyl]-2-methyl-1H-pyrazol-3-one |
| SMILES | COc1ccc(C(=O)c2c[nH]n(C)c2=O)c(C)c1N=S1(=O)CCCCC1 |
| InChI | InChI=1S/C18H23N3O4S/c1-12-13(17(22)14-11-19-21(2)18(14)23)7-8-15(25-3)16(12)20-26(24)9-5-4-6-10-26/h7-8,11,19H,4-6,9-10H2,1-3H3 |
| InChIKey | OIZKCMUXIOEKSF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |