C20H26ClN3O6S2 — CID 58308325
[4-[2-chloro-4-methoxy-3-[(1-oxothian-1-ylidene)amino]benzoyl]-1-methylpyrazol-5-yl] propane-1-sulfonate (PubChem CID 58308325) has the molecular formula C20H26ClN3O6S2 and a molecular weight of 504.03 g/mol. Its IUPAC name is [4-[2-chloro-4-methoxy-3-[(1-oxothian-1-ylidene)amino]benzoyl]-1-methylpyrazol-5-yl] propane-1-sulfonate.
| Compound Name | [4-[2-chloro-4-methoxy-3-[(1-oxothian-1-ylidene)amino]benzoyl]-1-methylpyrazol-5-yl] propane-1-sulfonate |
|---|---|
| PubChem CID | 58308325 |
| Molecular Formula | C20H26ClN3O6S2 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | [4-[2-chloro-4-methoxy-3-[(1-oxothian-1-ylidene)amino]benzoyl]-1-methylpyrazol-5-yl] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)Oc1c(C(=O)c2ccc(OC)c(N=S3(=O)CCCCC3)c2Cl)cnn1C |
| InChI | InChI=1S/C20H26ClN3O6S2/c1-4-10-32(27,28)30-20-15(13-22-24(20)2)19(25)14-8-9-16(29-3)18(17(14)21)23-31(26)11-6-5-7-12-31/h8-9,13H,4-7,10-12H2,1-3H3 |
| InChIKey | UNXQQLIAJRMWOD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 116.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|