C60H42N4 — CID 58309344
N,N-diphenyl-4-[3,5,6,8-tetradeuterio-4,7-diphenyl-9-[4-(N-phenylanilino)phenyl]-1,10-phenanthrolin-2-yl]aniline (PubChem CID 58309344) has the molecular formula C60H42N4 and a molecular weight of 823.05 g/mol. Its IUPAC name is N,N-diphenyl-4-[3,5,6,8-tetradeuterio-4,7-diphenyl-9-[4-(N-phenylanilino)phenyl]-1,10-phenanthrolin-2-yl]aniline.
| Compound Name | N,N-diphenyl-4-[3,5,6,8-tetradeuterio-4,7-diphenyl-9-[4-(N-phenylanilino)phenyl]-1,10-phenanthrolin-2-yl]aniline |
|---|---|
| PubChem CID | 58309344 |
| Molecular Formula | C60H42N4 |
| Molecular Weight | 823.05 g/mol |
| Exact Mass | 822.37 |
| IUPAC Name | N,N-diphenyl-4-[3,5,6,8-tetradeuterio-4,7-diphenyl-9-[4-(N-phenylanilino)phenyl]-1,10-phenanthrolin-2-yl]aniline |
| SMILES | [2H]c1c(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)nc2c(c([2H])c([2H])c3c(-c4ccccc4)c([2H])c(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)nc32)c1-c1ccccc1 |
| InChI | InChI=1S/C60H42N4/c1-7-19-43(20-8-1)55-41-57(45-31-35-51(36-32-45)63(47-23-11-3-12-24-47)48-25-13-4-14-26-48)61-59-53(55)39-40-54-56(44-21-9-2-10-22-44)42-58(62-60(54)59)46-33-37-52(38-34-46)64(49-27-15-5-16-28-49)50-29-17-6-18-30-50/h1-42H/i39D,40D,41D,42D |
| InChIKey | XRACBPVADFLCHA-JEELWCQFSA-N |
| XLogP | 16.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.05 |
| LogP ≤ 5 | 16.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|