C27H43NO6 — CID 58311070
tert-butyl 2-[(3S,13R,16S,17R,19S)-13-formyl-18,18-dimethyl-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate (PubChem CID 58311070) has the molecular formula C27H43NO6 and a molecular weight of 477.64 g/mol. Its IUPAC name is tert-butyl 2-[(3S,13R,16S,17R,19S)-13-formyl-18,18-dimethyl-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S,13R,16S,17R,19S)-13-formyl-18,18-dimethyl-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate |
|---|---|
| PubChem CID | 58311070 |
| Molecular Formula | C27H43NO6 |
| Molecular Weight | 477.64 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | tert-butyl 2-[(3S,13R,16S,17R,19S)-13-formyl-18,18-dimethyl-2,15-dioxo-5-oxa-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1COCCCCCCC[C@@H](C=O)CC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C |
| InChI | InChI=1S/C27H43NO6/c1-26(2,3)34-22(31)14-19-17-33-12-10-8-6-7-9-11-18(16-29)13-21(30)24-23-20(27(23,4)5)15-28(24)25(19)32/h16,18-20,23-24H,6-15,17H2,1-5H3/t18-,19+,20+,23+,24-/m1/s1 |
| InChIKey | BPVQOTAAGFCZEE-SVLHQOMZSA-N |
| XLogP | 3.96 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.64 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|