C32H52N2O6 — CID 58311411
2-[(3R,14R,17S,18R)-3-(4,4-dimethyl-2-oxopentyl)-20,20-dimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricosan-14-yl]-2-oxoacetamide (PubChem CID 58311411) has the molecular formula C32H52N2O6 and a molecular weight of 560.78 g/mol. Its IUPAC name is 2-[(3R,14R,17S,18R)-3-(4,4-dimethyl-2-oxopentyl)-20,20-dimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricosan-14-yl]-2-oxoacetamide.
| Compound Name | 2-[(3R,14R,17S,18R)-3-(4,4-dimethyl-2-oxopentyl)-20,20-dimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricosan-14-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 58311411 |
| Molecular Formula | C32H52N2O6 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.38 |
| IUPAC Name | 2-[(3R,14R,17S,18R)-3-(4,4-dimethyl-2-oxopentyl)-20,20-dimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricosan-14-yl]-2-oxoacetamide |
| SMILES | CC(C)(C)CC(=O)C[C@H]1CCCCCCCCCC[C@@H](C(=O)C(N)=O)CC(=O)[C@@H]2[C@H]3CC(C)(C)OC3CN2C1=O |
| InChI | InChI=1S/C32H52N2O6/c1-31(2,3)18-23(35)16-22-15-13-11-9-7-6-8-10-12-14-21(28(37)29(33)38)17-25(36)27-24-19-32(4,5)40-26(24)20-34(27)30(22)39/h21-22,24,26-27H,6-20H2,1-5H3,(H2,33,38)/t21-,22-,24+,26?,27+/m1/s1 |
| InChIKey | RDOSVZSIUYJRSF-AGWXCAEWSA-N |
| XLogP | 4.94 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|