C13H22O8 — CID 58312472
ethyl 2-(hydroxymethyl)-2-methyl-3-[2-(3-oxopropoxy)ethoxycarbonyloxy]propanoate (PubChem CID 58312472) has the molecular formula C13H22O8 and a molecular weight of 306.31 g/mol. Its IUPAC name is ethyl 2-(hydroxymethyl)-2-methyl-3-[2-(3-oxopropoxy)ethoxycarbonyloxy]propanoate.
| Compound Name | ethyl 2-(hydroxymethyl)-2-methyl-3-[2-(3-oxopropoxy)ethoxycarbonyloxy]propanoate |
|---|---|
| PubChem CID | 58312472 |
| Molecular Formula | C13H22O8 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | ethyl 2-(hydroxymethyl)-2-methyl-3-[2-(3-oxopropoxy)ethoxycarbonyloxy]propanoate |
| SMILES | CCOC(=O)C(C)(CO)COC(=O)OCCOCCC=O |
| InChI | InChI=1S/C13H22O8/c1-3-19-11(16)13(2,9-15)10-21-12(17)20-8-7-18-6-4-5-14/h5,15H,3-4,6-10H2,1-2H3 |
| InChIKey | MEFFQXSIDMRDGB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|