C11H19NO5 — CID 54410731
1-O-ethyl 4-O-(3-oxopropyl) (3S)-3-amino-2,2-dimethylbutanedioate (PubChem CID 54410731) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is 1-O-ethyl 4-O-(3-oxopropyl) (3S)-3-amino-2,2-dimethylbutanedioate.
| Compound Name | 1-O-ethyl 4-O-(3-oxopropyl) (3S)-3-amino-2,2-dimethylbutanedioate |
|---|---|
| PubChem CID | 54410731 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 1-O-ethyl 4-O-(3-oxopropyl) (3S)-3-amino-2,2-dimethylbutanedioate |
| SMILES | CCOC(=O)C(C)(C)[C@H](N)C(=O)OCCC=O |
| InChI | InChI=1S/C11H19NO5/c1-4-16-10(15)11(2,3)8(12)9(14)17-7-5-6-13/h6,8H,4-5,7,12H2,1-3H3/t8-/m1/s1 |
| InChIKey | JIXJTLCOGQGAJG-MRVPVSSYSA-N |
| XLogP | 0.04 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|