C26H25N5O2S — CID 58312720
(5Z)-5-[[2-[4-[(4-methylphenyl)-phenylmethyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58312720) has the molecular formula C26H25N5O2S and a molecular weight of 471.59 g/mol. Its IUPAC name is (5Z)-5-[[2-[4-[(4-methylphenyl)-phenylmethyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[4-[(4-methylphenyl)-phenylmethyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58312720 |
| Molecular Formula | C26H25N5O2S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | (5Z)-5-[[2-[4-[(4-methylphenyl)-phenylmethyl]piperazin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(C(c2ccccc2)N2CCN(c3nccc(/C=C4\SC(=O)NC4=O)n3)CC2)cc1 |
| InChI | InChI=1S/C26H25N5O2S/c1-18-7-9-20(10-8-18)23(19-5-3-2-4-6-19)30-13-15-31(16-14-30)25-27-12-11-21(28-25)17-22-24(32)29-26(33)34-22/h2-12,17,23H,13-16H2,1H3,(H,29,32,33)/b22-17- |
| InChIKey | QJFNWLFDOKTYLB-XLNRJJMWSA-N |
| XLogP | 4.02 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|