C27H37N7O3 — CID 58313823
(3E)-3-[[4-(cyclopropylamino)-2-[[4-(4,5-dimethyl-2-oxohexyl)cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58313823) has the molecular formula C27H37N7O3 and a molecular weight of 507.64 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[[4-(4,5-dimethyl-2-oxohexyl)cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[[4-(4,5-dimethyl-2-oxohexyl)cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58313823 |
| Molecular Formula | C27H37N7O3 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[[4-(4,5-dimethyl-2-oxohexyl)cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CC(C)C(C)CC(=O)CC1CCC(Nc2nc(NC3CC3)n3ncc(/C=C4\CC(=O)NC4=O)c3n2)CC1 |
| InChI | InChI=1S/C27H37N7O3/c1-15(2)16(3)10-22(35)11-17-4-6-20(7-5-17)29-26-32-24-19(12-18-13-23(36)31-25(18)37)14-28-34(24)27(33-26)30-21-8-9-21/h12,14-17,20-21H,4-11,13H2,1-3H3,(H,31,36,37)(H2,29,30,32,33)/b18-12+ |
| InChIKey | MJEFNRDVCPRBIM-LDADJPATSA-N |
| XLogP | 3.74 |
| TPSA | 130.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|