C27H33N9O2 — CID 58314641
(3E)-3-[[4-(cyclopropylamino)-2-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314641) has the molecular formula C27H33N9O2 and a molecular weight of 515.62 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314641 |
| Molecular Formula | C27H33N9O2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CCN1CCN(Cc2ccc(CNc3nc(NC4CC4)n4ncc(/C=C5\CC(=O)NC5=O)c4n3)cc2)CC1 |
| InChI | InChI=1S/C27H33N9O2/c1-2-34-9-11-35(12-10-34)17-19-5-3-18(4-6-19)15-28-26-32-24-21(13-20-14-23(37)31-25(20)38)16-29-36(24)27(33-26)30-22-7-8-22/h3-6,13,16,22H,2,7-12,14-15,17H2,1H3,(H,31,37,38)(H2,28,30,32,33)/b20-13+ |
| InChIKey | KGHGKLITLRQBEK-DEDYPNTBSA-N |
| XLogP | 1.88 |
| TPSA | 119.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|