C26H27F2N7O4S — CID 58314777
(3E)-3-[[4-(cyclopropylamino)-2-[[4-[(2,4-difluorophenyl)sulfonylmethyl]cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314777) has the molecular formula C26H27F2N7O4S and a molecular weight of 571.61 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[[4-[(2,4-difluorophenyl)sulfonylmethyl]cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[[4-[(2,4-difluorophenyl)sulfonylmethyl]cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314777 |
| Molecular Formula | C26H27F2N7O4S |
| Molecular Weight | 571.61 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[[4-[(2,4-difluorophenyl)sulfonylmethyl]cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(NC4CCC(CS(=O)(=O)c5ccc(F)cc5F)CC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C26H27F2N7O4S/c27-17-3-8-21(20(28)11-17)40(38,39)13-14-1-4-18(5-2-14)30-25-33-23-16(9-15-10-22(36)32-24(15)37)12-29-35(23)26(34-25)31-19-6-7-19/h3,8-9,11-12,14,18-19H,1-2,4-7,10,13H2,(H,32,36,37)(H2,30,31,33,34)/b15-9+ |
| InChIKey | INWGKZKYGFNMEA-OQLLNIDSSA-N |
| XLogP | 2.85 |
| TPSA | 147.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|