C26H28FN7O4S — CID 58314900
(3E)-3-[[4-(cyclopropylamino)-2-[[4-[(3-fluorophenyl)sulfonylmethyl]cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314900) has the molecular formula C26H28FN7O4S and a molecular weight of 553.62 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[[4-[(3-fluorophenyl)sulfonylmethyl]cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[[4-[(3-fluorophenyl)sulfonylmethyl]cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314900 |
| Molecular Formula | C26H28FN7O4S |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[[4-[(3-fluorophenyl)sulfonylmethyl]cyclohexyl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(NC4CCC(CS(=O)(=O)c5cccc(F)c5)CC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C26H28FN7O4S/c27-18-2-1-3-21(12-18)39(37,38)14-15-4-6-19(7-5-15)29-25-32-23-17(10-16-11-22(35)31-24(16)36)13-28-34(23)26(33-25)30-20-8-9-20/h1-3,10,12-13,15,19-20H,4-9,11,14H2,(H,31,35,36)(H2,29,30,32,33)/b16-10+ |
| InChIKey | UFIPARKELYYBSB-MHWRWJLKSA-N |
| XLogP | 2.71 |
| TPSA | 147.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|