C18H22N8O4S — CID 58315162
(3E)-3-[[4-(cyclopropylamino)-2-(4-methylsulfonylpiperazin-1-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58315162) has the molecular formula C18H22N8O4S and a molecular weight of 446.49 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-(4-methylsulfonylpiperazin-1-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-(4-methylsulfonylpiperazin-1-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58315162 |
| Molecular Formula | C18H22N8O4S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-(4-methylsulfonylpiperazin-1-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CS(=O)(=O)N1CCN(c2nc(NC3CC3)n3ncc(/C=C4\CC(=O)NC4=O)c3n2)CC1 |
| InChI | InChI=1S/C18H22N8O4S/c1-31(29,30)25-6-4-24(5-7-25)17-22-15-12(8-11-9-14(27)21-16(11)28)10-19-26(15)18(23-17)20-13-2-3-13/h8,10,13H,2-7,9H2,1H3,(H,20,22,23)(H,21,27,28)/b11-8+ |
| InChIKey | AOMKTGMBMVKDEK-DHZHZOJOSA-N |
| XLogP | -0.79 |
| TPSA | 141.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|