C16H20FNO3 — CID 58317079
4-(3-cyclopropylpropyl)-6-(1-fluoroethyl)-7,8-dihydropyrano[3,2-c]pyridine-2,5-dione (PubChem CID 58317079) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-(3-cyclopropylpropyl)-6-(1-fluoroethyl)-7,8-dihydropyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | 4-(3-cyclopropylpropyl)-6-(1-fluoroethyl)-7,8-dihydropyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 58317079 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-(3-cyclopropylpropyl)-6-(1-fluoroethyl)-7,8-dihydropyrano[3,2-c]pyridine-2,5-dione |
| SMILES | CC(F)N1CCc2oc(=O)cc(CCCC3CC3)c2C1=O |
| InChI | InChI=1S/C16H20FNO3/c1-10(17)18-8-7-13-15(16(18)20)12(9-14(19)21-13)4-2-3-11-5-6-11/h9-11H,2-8H2,1H3 |
| InChIKey | GKCKQCZRKQHGJH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|