C15H18FNO4 — CID 58317199
6-(fluoromethyl)-4-hexyl-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58317199) has the molecular formula C15H18FNO4 and a molecular weight of 295.31 g/mol. Its IUPAC name is 6-(fluoromethyl)-4-hexyl-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 6-(fluoromethyl)-4-hexyl-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58317199 |
| Molecular Formula | C15H18FNO4 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 6-(fluoromethyl)-4-hexyl-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | CCCCCCc1cc(=O)oc2c1C(=O)N(CF)C(=O)C2 |
| InChI | InChI=1S/C15H18FNO4/c1-2-3-4-5-6-10-7-13(19)21-11-8-12(18)17(9-16)15(20)14(10)11/h7H,2-6,8-9H2,1H3 |
| InChIKey | ZUIHUVGJNGSVFD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|