C16H17F2NO4 — CID 58317122
6-cyclobutyl-4-(4,4-difluorobutyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58317122) has the molecular formula C16H17F2NO4 and a molecular weight of 325.31 g/mol. Its IUPAC name is 6-cyclobutyl-4-(4,4-difluorobutyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 6-cyclobutyl-4-(4,4-difluorobutyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58317122 |
| Molecular Formula | C16H17F2NO4 |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 6-cyclobutyl-4-(4,4-difluorobutyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | O=C1Cc2oc(=O)cc(CCCC(F)F)c2C(=O)N1C1CCC1 |
| InChI | InChI=1S/C16H17F2NO4/c17-12(18)6-1-3-9-7-14(21)23-11-8-13(20)19(10-4-2-5-10)16(22)15(9)11/h7,10,12H,1-6,8H2 |
| InChIKey | QFGTUYOAYRKUAT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|