C16H10N2O4 — CID 58317133
3-[(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)methyl]benzonitrile (PubChem CID 58317133) has the molecular formula C16H10N2O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is 3-[(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)methyl]benzonitrile.
| Compound Name | 3-[(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 58317133 |
| Molecular Formula | C16H10N2O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 3-[(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)methyl]benzonitrile |
| SMILES | N#Cc1cccc(Cc2cc(=O)oc3c2C(=O)NC(=O)C3)c1 |
| InChI | InChI=1S/C16H10N2O4/c17-8-10-3-1-2-9(4-10)5-11-6-14(20)22-12-7-13(19)18-16(21)15(11)12/h1-4,6H,5,7H2,(H,18,19,21) |
| InChIKey | GWAFHIQSBKIWDR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|