C15H10FNO4 — CID 58317169
4-[(3-fluorophenyl)methyl]-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58317169) has the molecular formula C15H10FNO4 and a molecular weight of 287.25 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)methyl]-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-[(3-fluorophenyl)methyl]-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58317169 |
| Molecular Formula | C15H10FNO4 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-[(3-fluorophenyl)methyl]-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | O=C1Cc2oc(=O)cc(Cc3cccc(F)c3)c2C(=O)N1 |
| InChI | InChI=1S/C15H10FNO4/c16-10-3-1-2-8(5-10)4-9-6-13(19)21-11-7-12(18)17-15(20)14(9)11/h1-3,5-6H,4,7H2,(H,17,18,20) |
| InChIKey | JRXPSSZMYMGYHT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|