C26H25ClF3NO — CID 58317298
1-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(2-isoquinolin-1-ylethyl)cyclohexyl]ethanone (PubChem CID 58317298) has the molecular formula C26H25ClF3NO and a molecular weight of 459.94 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(2-isoquinolin-1-ylethyl)cyclohexyl]ethanone.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(2-isoquinolin-1-ylethyl)cyclohexyl]ethanone |
|---|---|
| PubChem CID | 58317298 |
| Molecular Formula | C26H25ClF3NO |
| Molecular Weight | 459.94 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(2-isoquinolin-1-ylethyl)cyclohexyl]ethanone |
| SMILES | O=C(CC1CCC(CCc2nccc3ccccc23)CC1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C26H25ClF3NO/c27-23-11-10-20(26(28,29)30)16-22(23)25(32)15-18-7-5-17(6-8-18)9-12-24-21-4-2-1-3-19(21)13-14-31-24/h1-4,10-11,13-14,16-18H,5-9,12,15H2 |
| InChIKey | GVNZMNLZINHKOZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.94 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |