C21H35BrO5 — CID 58318311
(1S,5R,8S,9R,10S,12R,13R)-10-(5-bromopentoxy)-1,5,9,10-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 58318311) has the molecular formula C21H35BrO5 and a molecular weight of 447.41 g/mol. Its IUPAC name is (1S,5R,8S,9R,10S,12R,13R)-10-(5-bromopentoxy)-1,5,9,10-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,5R,8S,9R,10S,12R,13R)-10-(5-bromopentoxy)-1,5,9,10-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 58318311 |
| Molecular Formula | C21H35BrO5 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (1S,5R,8S,9R,10S,12R,13R)-10-(5-bromopentoxy)-1,5,9,10-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)[C@@](C)(OCCCCCBr)O[C@@H]3O[C@]4(C)CCC1[C@]32OO4 |
| InChI | InChI=1S/C21H35BrO5/c1-14-8-9-17-15(2)20(4,23-13-7-5-6-12-22)25-18-21(17)16(14)10-11-19(3,24-18)26-27-21/h14-18H,5-13H2,1-4H3/t14-,15-,16?,17+,18+,19+,20+,21-/m1/s1 |
| InChIKey | VIBSBCRBOPCSBV-ALHDLULQSA-N |
| XLogP | 5.17 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|