C29H50N2O7 — CID 160839644
tert-butyl 4-[methyl-[2-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9,10-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]amino]piperidine-1-carboxylate (PubChem CID 160839644) has the molecular formula C29H50N2O7 and a molecular weight of 538.73 g/mol. Its IUPAC name is tert-butyl 4-[methyl-[2-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9,10-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[methyl-[2-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9,10-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 160839644 |
| Molecular Formula | C29H50N2O7 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.36 |
| IUPAC Name | tert-butyl 4-[methyl-[2-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9,10-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]amino]piperidine-1-carboxylate |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)[C@@](C)(OCCN(C)C3CCN(C(=O)OC(C)(C)C)CC3)O[C@@H]3O[C@@]4(C)CCC1[C@]32OO4 |
| InChI | InChI=1S/C29H50N2O7/c1-19-9-10-23-20(2)28(7,35-24-29(23)22(19)11-14-27(6,34-24)37-38-29)33-18-17-30(8)21-12-15-31(16-13-21)25(32)36-26(3,4)5/h19-24H,9-18H2,1-8H3/t19-,20-,22?,23+,24+,27-,28+,29-/m1/s1 |
| InChIKey | QLELNAOCAODNBT-KJZKPSOSSA-N |
| XLogP | 4.93 |
| TPSA | 78.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|