C17H11F2N3O2 — CID 58318837
2-(6-fluoro-2-pyridinyl)-1-(3-fluoro-5-pyrimidin-5-yloxyphenyl)ethanone (PubChem CID 58318837) has the molecular formula C17H11F2N3O2 and a molecular weight of 327.29 g/mol. Its IUPAC name is 2-(6-fluoro-2-pyridinyl)-1-(3-fluoro-5-pyrimidin-5-yloxyphenyl)ethanone.
| Compound Name | 2-(6-fluoro-2-pyridinyl)-1-(3-fluoro-5-pyrimidin-5-yloxyphenyl)ethanone |
|---|---|
| PubChem CID | 58318837 |
| Molecular Formula | C17H11F2N3O2 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-(6-fluoro-2-pyridinyl)-1-(3-fluoro-5-pyrimidin-5-yloxyphenyl)ethanone |
| SMILES | O=C(Cc1cccc(F)n1)c1cc(F)cc(Oc2cncnc2)c1 |
| InChI | InChI=1S/C17H11F2N3O2/c18-12-4-11(16(23)7-13-2-1-3-17(19)22-13)5-14(6-12)24-15-8-20-10-21-9-15/h1-6,8-10H,7H2 |
| InChIKey | GFJLQEGVFWYQRM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|