C18H11F4N3O2 — CID 58318859
1-(3-fluoro-5-pyrimidin-5-yloxyphenyl)-2-[6-(trifluoromethyl)-2-pyridinyl]ethanone (PubChem CID 58318859) has the molecular formula C18H11F4N3O2 and a molecular weight of 377.30 g/mol. Its IUPAC name is 1-(3-fluoro-5-pyrimidin-5-yloxyphenyl)-2-[6-(trifluoromethyl)-2-pyridinyl]ethanone.
| Compound Name | 1-(3-fluoro-5-pyrimidin-5-yloxyphenyl)-2-[6-(trifluoromethyl)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 58318859 |
| Molecular Formula | C18H11F4N3O2 |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 1-(3-fluoro-5-pyrimidin-5-yloxyphenyl)-2-[6-(trifluoromethyl)-2-pyridinyl]ethanone |
| SMILES | O=C(Cc1cccc(C(F)(F)F)n1)c1cc(F)cc(Oc2cncnc2)c1 |
| InChI | InChI=1S/C18H11F4N3O2/c19-12-4-11(5-14(6-12)27-15-8-23-10-24-9-15)16(26)7-13-2-1-3-17(25-13)18(20,21)22/h1-6,8-10H,7H2 |
| InChIKey | BQVMTQQREQHDSO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |