C8H11FN4S — CID 58318932
N'-(5-fluoro-2-methylsulfanylpyrimidin-4-yl)-N,N-dimethylmethanimidamide (PubChem CID 58318932) has the molecular formula C8H11FN4S and a molecular weight of 214.27 g/mol. Its IUPAC name is N'-(5-fluoro-2-methylsulfanylpyrimidin-4-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(5-fluoro-2-methylsulfanylpyrimidin-4-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 58318932 |
| Molecular Formula | C8H11FN4S |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | N'-(5-fluoro-2-methylsulfanylpyrimidin-4-yl)-N,N-dimethylmethanimidamide |
| SMILES | CSc1ncc(F)c(/N=C/N(C)C)n1 |
| InChI | InChI=1S/C8H11FN4S/c1-13(2)5-11-7-6(9)4-10-8(12-7)14-3/h4-5H,1-3H3/b11-5+ |
| InChIKey | BPEYSBHUMGEDKI-VZUCSPMQSA-N |
| XLogP | 1.56 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|