C19H15F2N3O5 — CID 58319260
N-[(1R)-1-(3,5-difluoro-4-methylphenyl)ethyl]-2-(3-nitrophenoxy)-1,3-oxazole-4-carboxamide (PubChem CID 58319260) has the molecular formula C19H15F2N3O5 and a molecular weight of 403.34 g/mol. Its IUPAC name is N-[(1R)-1-(3,5-difluoro-4-methylphenyl)ethyl]-2-(3-nitrophenoxy)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(1R)-1-(3,5-difluoro-4-methylphenyl)ethyl]-2-(3-nitrophenoxy)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 58319260 |
| Molecular Formula | C19H15F2N3O5 |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-[(1R)-1-(3,5-difluoro-4-methylphenyl)ethyl]-2-(3-nitrophenoxy)-1,3-oxazole-4-carboxamide |
| SMILES | Cc1c(F)cc([C@@H](C)NC(=O)c2coc(Oc3cccc([N+](=O)[O-])c3)n2)cc1F |
| InChI | InChI=1S/C19H15F2N3O5/c1-10-15(20)6-12(7-16(10)21)11(2)22-18(25)17-9-28-19(23-17)29-14-5-3-4-13(8-14)24(26)27/h3-9,11H,1-2H3,(H,22,25)/t11-/m1/s1 |
| InChIKey | KGHNENBGJQSWOY-LLVKDONJSA-N |
| XLogP | 4.45 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|