C19H16F2N4O7S — CID 67238143
N-[1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-2-(3-nitrophenoxy)-1,3-oxazole-4-carboxamide (PubChem CID 67238143) has the molecular formula C19H16F2N4O7S and a molecular weight of 482.42 g/mol. Its IUPAC name is N-[1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-2-(3-nitrophenoxy)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-2-(3-nitrophenoxy)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 67238143 |
| Molecular Formula | C19H16F2N4O7S |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | N-[1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-2-(3-nitrophenoxy)-1,3-oxazole-4-carboxamide |
| SMILES | CC(NC(=O)c1coc(Oc2cccc([N+](=O)[O-])c2)n1)c1cc(F)c(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C19H16F2N4O7S/c1-10(11-6-14(20)17(15(21)7-11)24-33(2,29)30)22-18(26)16-9-31-19(23-16)32-13-5-3-4-12(8-13)25(27)28/h3-10,24H,1-2H3,(H,22,26) |
| InChIKey | VPLDDENRNFKFER-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 153.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|