C23H25F2N3O5S — CID 70924562
2-(2-butoxyphenyl)-N-[(1R)-1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-1,3-oxazole-4-carboxamide (PubChem CID 70924562) has the molecular formula C23H25F2N3O5S and a molecular weight of 493.53 g/mol. Its IUPAC name is 2-(2-butoxyphenyl)-N-[(1R)-1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2-butoxyphenyl)-N-[(1R)-1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 70924562 |
| Molecular Formula | C23H25F2N3O5S |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 2-(2-butoxyphenyl)-N-[(1R)-1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCCCOc1ccccc1-c1nc(C(=O)N[C@H](C)c2cc(F)c(NS(C)(=O)=O)c(F)c2)co1 |
| InChI | InChI=1S/C23H25F2N3O5S/c1-4-5-10-32-20-9-7-6-8-16(20)23-27-19(13-33-23)22(29)26-14(2)15-11-17(24)21(18(25)12-15)28-34(3,30)31/h6-9,11-14,28H,4-5,10H2,1-3H3,(H,26,29)/t14-/m1/s1 |
| InChIKey | UCAQLSACHXRDBT-CQSZACIVSA-N |
| XLogP | 4.66 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|