C27H34ClN7O2 — CID 58324881
tert-butyl N-[(1S,3R)-5-[[[2-[(2-chloro-3-pyridinyl)methylamino]-5-cyanopyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate (PubChem CID 58324881) has the molecular formula C27H34ClN7O2 and a molecular weight of 524.07 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-5-[[[2-[(2-chloro-3-pyridinyl)methylamino]-5-cyanopyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3R)-5-[[[2-[(2-chloro-3-pyridinyl)methylamino]-5-cyanopyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate |
|---|---|
| PubChem CID | 58324881 |
| Molecular Formula | C27H34ClN7O2 |
| Molecular Weight | 524.07 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | tert-butyl N-[(1S,3R)-5-[[[2-[(2-chloro-3-pyridinyl)methylamino]-5-cyanopyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1[C@@H]2CC3C[C@H]1CC(CNc1nc(NCc4cccnc4Cl)ncc1C#N)(C3)C2 |
| InChI | InChI=1S/C27H34ClN7O2/c1-26(2,3)37-25(36)34-21-18-7-16-8-19(21)11-27(9-16,10-18)15-33-23-20(12-29)14-32-24(35-23)31-13-17-5-4-6-30-22(17)28/h4-6,14,16,18-19,21H,7-11,13,15H2,1-3H3,(H,34,36)(H2,31,32,33,35)/t16?,18-,19+,21?,27? |
| InChIKey | WDLYMBAAHHGFTE-LWAKJXDZSA-N |
| XLogP | 5.14 |
| TPSA | 124.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.07 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|