C22H27ClN6O2 — CID 58325175
4-N-[[(3S,5R)-4-amino-1-adamantyl]methyl]-2-N-[(2-chlorophenyl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 58325175) has the molecular formula C22H27ClN6O2 and a molecular weight of 442.95 g/mol. Its IUPAC name is 4-N-[[(3S,5R)-4-amino-1-adamantyl]methyl]-2-N-[(2-chlorophenyl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-[[(3S,5R)-4-amino-1-adamantyl]methyl]-2-N-[(2-chlorophenyl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 58325175 |
| Molecular Formula | C22H27ClN6O2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 4-N-[[(3S,5R)-4-amino-1-adamantyl]methyl]-2-N-[(2-chlorophenyl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | NC1[C@@H]2CC3C[C@H]1CC(CNc1nc(NCc4ccccc4Cl)ncc1[N+](=O)[O-])(C3)C2 |
| InChI | InChI=1S/C22H27ClN6O2/c23-17-4-2-1-3-14(17)10-25-21-26-11-18(29(30)31)20(28-21)27-12-22-7-13-5-15(8-22)19(24)16(6-13)9-22/h1-4,11,13,15-16,19H,5-10,12,24H2,(H2,25,26,27,28)/t13?,15-,16+,19?,22? |
| InChIKey | ADVBGOVHJIOIJI-FXNAUTRCSA-N |
| XLogP | 4.22 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|