C14H22N2O3 — CID 58326089
1,1,2,3,3-pentadeuterio-1-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-3-[2-(trideuteriomethoxy)phenoxy]propan-2-ol (PubChem CID 58326089) has the molecular formula C14H22N2O3 and a molecular weight of 282.44 g/mol. Its IUPAC name is 1,1,2,3,3-pentadeuterio-1-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-3-[2-(trideuteriomethoxy)phenoxy]propan-2-ol.
| Compound Name | 1,1,2,3,3-pentadeuterio-1-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-3-[2-(trideuteriomethoxy)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 58326089 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 282.44 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | 1,1,2,3,3-pentadeuterio-1-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-3-[2-(trideuteriomethoxy)phenoxy]propan-2-ol |
| SMILES | [2H]C([2H])([2H])Oc1ccccc1OC([2H])([2H])C([2H])(O)C([2H])([2H])N1C([2H])([2H])C([2H])([2H])NC([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C14H22N2O3/c1-18-13-4-2-3-5-14(13)19-11-12(17)10-16-8-6-15-7-9-16/h2-5,12,15,17H,6-11H2,1H3/i1D3,6D2,7D2,8D2,9D2,10D2,11D2,12D |
| InChIKey | HVPPJURUTODQOY-ILVXFZMRSA-N |
| XLogP | 0.34 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.44 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |