C22H28N2O6 — CID 58327275
methyl (2S)-3-[4-(2,3-dimethyl-1-oxidopyridin-1-ium-4-yl)oxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 58327275) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is methyl (2S)-3-[4-(2,3-dimethyl-1-oxidopyridin-1-ium-4-yl)oxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2S)-3-[4-(2,3-dimethyl-1-oxidopyridin-1-ium-4-yl)oxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 58327275 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | methyl (2S)-3-[4-(2,3-dimethyl-1-oxidopyridin-1-ium-4-yl)oxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(Oc2cc[n+]([O-])c(C)c2C)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H28N2O6/c1-14-15(2)24(27)12-11-19(14)29-17-9-7-16(8-10-17)13-18(20(25)28-6)23-21(26)30-22(3,4)5/h7-12,18H,13H2,1-6H3,(H,23,26)/t18-/m0/s1 |
| InChIKey | NDWXYQHZWUKYDX-SFHVURJKSA-N |
| XLogP | 3.34 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|