C20H21NO — CID 58329222
6-[1-(3-methoxy-4,5-dimethylphenyl)ethyl]quinoline (PubChem CID 58329222) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is 6-[1-(3-methoxy-4,5-dimethylphenyl)ethyl]quinoline.
| Compound Name | 6-[1-(3-methoxy-4,5-dimethylphenyl)ethyl]quinoline |
|---|---|
| PubChem CID | 58329222 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 6-[1-(3-methoxy-4,5-dimethylphenyl)ethyl]quinoline |
| SMILES | COc1cc(C(C)c2ccc3ncccc3c2)cc(C)c1C |
| InChI | InChI=1S/C20H21NO/c1-13-10-18(12-20(22-4)14(13)2)15(3)16-7-8-19-17(11-16)6-5-9-21-19/h5-12,15H,1-4H3 |
| InChIKey | JYMFIXWDHPAHGK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |