C43H39NO8 — CID 58329942
(3R,4S,5R)-3-(4-methoxyphenyl)-2-[(E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-4-nitro-5-(4-phenylmethoxyphenyl)cyclohexan-1-one (PubChem CID 58329942) has the molecular formula C43H39NO8 and a molecular weight of 697.78 g/mol. Its IUPAC name is (3R,4S,5R)-3-(4-methoxyphenyl)-2-[(E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-4-nitro-5-(4-phenylmethoxyphenyl)cyclohexan-1-one.
| Compound Name | (3R,4S,5R)-3-(4-methoxyphenyl)-2-[(E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-4-nitro-5-(4-phenylmethoxyphenyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 58329942 |
| Molecular Formula | C43H39NO8 |
| Molecular Weight | 697.78 g/mol |
| Exact Mass | 697.27 |
| IUPAC Name | (3R,4S,5R)-3-(4-methoxyphenyl)-2-[(E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-4-nitro-5-(4-phenylmethoxyphenyl)cyclohexan-1-one |
| SMILES | COc1ccc([C@H]2C(C(=O)/C=C/c3ccc(OCc4ccccc4)c(OC)c3)C(=O)C[C@H](c3ccc(OCc4ccccc4)cc3)[C@@H]2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C43H39NO8/c1-49-34-19-17-33(18-20-34)41-42(37(45)23-13-29-14-24-39(40(25-29)50-2)52-28-31-11-7-4-8-12-31)38(46)26-36(43(41)44(47)48)32-15-21-35(22-16-32)51-27-30-9-5-3-6-10-30/h3-25,36,41-43H,26-28H2,1-2H3/b23-13+/t36-,41+,42?,43+/m1/s1 |
| InChIKey | VDXWQEQWJPPVRL-BZHKWWPPSA-N |
| XLogP | 8.25 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.78 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|