C23H20O6 — CID 6173988
3-[(E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-6-methylpyran-2,4-dione (PubChem CID 6173988) has the molecular formula C23H20O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is 3-[(E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-6-methylpyran-2,4-dione.
| Compound Name | 3-[(E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-6-methylpyran-2,4-dione |
|---|---|
| PubChem CID | 6173988 |
| Molecular Formula | C23H20O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 3-[(E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-6-methylpyran-2,4-dione |
| SMILES | COc1cc(/C=C/C(=O)C2C(=O)C=C(C)OC2=O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H20O6/c1-15-12-19(25)22(23(26)29-15)18(24)10-8-16-9-11-20(21(13-16)27-2)28-14-17-6-4-3-5-7-17/h3-13,22H,14H2,1-2H3/b10-8+ |
| InChIKey | BAADPLBZMWSGHB-CSKARUKUSA-N |
| XLogP | 3.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|