C9H12N3+ — CID 58332190
4-propan-2-yl-4aH-pyrrolo[2,1-f][1,2,4]triazin-8-ium (PubChem CID 58332190) has the molecular formula C9H12N3+ and a molecular weight of 162.22 g/mol. Its IUPAC name is 4-propan-2-yl-4aH-pyrrolo[2,1-f][1,2,4]triazin-8-ium.
| Compound Name | 4-propan-2-yl-4aH-pyrrolo[2,1-f][1,2,4]triazin-8-ium |
|---|---|
| PubChem CID | 58332190 |
| Molecular Formula | C9H12N3+ |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 4-propan-2-yl-4aH-pyrrolo[2,1-f][1,2,4]triazin-8-ium |
| SMILES | CC(C)C1=NC=N[N+]2=CC=CC12 |
| InChI | InChI=1S/C9H12N3/c1-7(2)9-8-4-3-5-12(8)11-6-10-9/h3-8H,1-2H3/q+1 |
| InChIKey | BVJDZNJOMCTCJD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 27.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|