C15H23N2+ — CID 167350353
5,6-ditert-butyl-4aH-pyrrolo[1,2-b]pyridazin-8-ium (PubChem CID 167350353) has the molecular formula C15H23N2+ and a molecular weight of 231.36 g/mol. Its IUPAC name is 5,6-ditert-butyl-4aH-pyrrolo[1,2-b]pyridazin-8-ium.
| Compound Name | 5,6-ditert-butyl-4aH-pyrrolo[1,2-b]pyridazin-8-ium |
|---|---|
| PubChem CID | 167350353 |
| Molecular Formula | C15H23N2+ |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | 5,6-ditert-butyl-4aH-pyrrolo[1,2-b]pyridazin-8-ium |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)C2C=CC=N[N+]2=C1 |
| InChI | InChI=1S/C15H23N2/c1-14(2,3)11-10-17-12(8-7-9-16-17)13(11)15(4,5)6/h7-10,12H,1-6H3/q+1 |
| InChIKey | ZKIDWAPUVAZQEA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|