C10H13N2+ — CID 166028669
3-propan-2-yl-4aH-pyrrolo[1,2-b]pyridazin-8-ium (PubChem CID 166028669) has the molecular formula C10H13N2+ and a molecular weight of 161.23 g/mol. Its IUPAC name is 3-propan-2-yl-4aH-pyrrolo[1,2-b]pyridazin-8-ium.
| Compound Name | 3-propan-2-yl-4aH-pyrrolo[1,2-b]pyridazin-8-ium |
|---|---|
| PubChem CID | 166028669 |
| Molecular Formula | C10H13N2+ |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 3-propan-2-yl-4aH-pyrrolo[1,2-b]pyridazin-8-ium |
| SMILES | CC(C)C1=CC2C=CC=[N+]2N=C1 |
| InChI | InChI=1S/C10H13N2/c1-8(2)9-6-10-4-3-5-12(10)11-7-9/h3-8,10H,1-2H3/q+1 |
| InChIKey | VYPLXEZCHIUVJO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|