C22H17F3O5S — CID 58333690
2-[2-(4-benzylsulfonylphenyl)-4-(trifluoromethyl)phenoxy]acetic acid (PubChem CID 58333690) has the molecular formula C22H17F3O5S and a molecular weight of 450.43 g/mol. Its IUPAC name is 2-[2-(4-benzylsulfonylphenyl)-4-(trifluoromethyl)phenoxy]acetic acid.
| Compound Name | 2-[2-(4-benzylsulfonylphenyl)-4-(trifluoromethyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 58333690 |
| Molecular Formula | C22H17F3O5S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 2-[2-(4-benzylsulfonylphenyl)-4-(trifluoromethyl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C(F)(F)F)cc1-c1ccc(S(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H17F3O5S/c23-22(24,25)17-8-11-20(30-13-21(26)27)19(12-17)16-6-9-18(10-7-16)31(28,29)14-15-4-2-1-3-5-15/h1-12H,13-14H2,(H,26,27) |
| InChIKey | RWMGPAYEHAFPOK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |