C20H21NO4 — CID 58335348
1-[6-methoxy-4-methyl-7-(3-phenylpropoxy)-1,3-benzoxazol-5-yl]ethanone (PubChem CID 58335348) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-[6-methoxy-4-methyl-7-(3-phenylpropoxy)-1,3-benzoxazol-5-yl]ethanone.
| Compound Name | 1-[6-methoxy-4-methyl-7-(3-phenylpropoxy)-1,3-benzoxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 58335348 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-[6-methoxy-4-methyl-7-(3-phenylpropoxy)-1,3-benzoxazol-5-yl]ethanone |
| SMILES | COc1c(C(C)=O)c(C)c2ncoc2c1OCCCc1ccccc1 |
| InChI | InChI=1S/C20H21NO4/c1-13-16(14(2)22)18(23-3)20(19-17(13)21-12-25-19)24-11-7-10-15-8-5-4-6-9-15/h4-6,8-9,12H,7,10-11H2,1-3H3 |
| InChIKey | JGIKLAZBMYYUHZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|