C24H23ClF4N4O3 — CID 58337253
N-[amino-[7-chloro-1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-5-yl]methylidene]-2-(4-fluoropiperidin-1-yl)acetamide (PubChem CID 58337253) has the molecular formula C24H23ClF4N4O3 and a molecular weight of 526.92 g/mol. Its IUPAC name is N-[amino-[7-chloro-1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-5-yl]methylidene]-2-(4-fluoropiperidin-1-yl)acetamide.
| Compound Name | N-[amino-[7-chloro-1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-5-yl]methylidene]-2-(4-fluoropiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 58337253 |
| Molecular Formula | C24H23ClF4N4O3 |
| Molecular Weight | 526.92 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | N-[amino-[7-chloro-1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-5-yl]methylidene]-2-(4-fluoropiperidin-1-yl)acetamide |
| SMILES | N/C(=N\C(=O)CN1CCC(F)CC1)c1cc(Cl)c2c(c1)CN(Cc1ccc(OC(F)(F)F)cc1)C2=O |
| InChI | InChI=1S/C24H23ClF4N4O3/c25-19-10-15(22(30)31-20(34)13-32-7-5-17(26)6-8-32)9-16-12-33(23(35)21(16)19)11-14-1-3-18(4-2-14)36-24(27,28)29/h1-4,9-10,17H,5-8,11-13H2,(H2,30,31,34) |
| InChIKey | VUOTZSCVNDMNHC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.92 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|