C21H19FN2O — CID 58337531
2-[3-fluoro-5-[methyl(pyridin-3-yl)amino]phenyl]-1-(3-methylphenyl)ethanone (PubChem CID 58337531) has the molecular formula C21H19FN2O and a molecular weight of 334.39 g/mol. Its IUPAC name is 2-[3-fluoro-5-[methyl(pyridin-3-yl)amino]phenyl]-1-(3-methylphenyl)ethanone.
| Compound Name | 2-[3-fluoro-5-[methyl(pyridin-3-yl)amino]phenyl]-1-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 58337531 |
| Molecular Formula | C21H19FN2O |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-[3-fluoro-5-[methyl(pyridin-3-yl)amino]phenyl]-1-(3-methylphenyl)ethanone |
| SMILES | Cc1cccc(C(=O)Cc2cc(F)cc(N(C)c3cccnc3)c2)c1 |
| InChI | InChI=1S/C21H19FN2O/c1-15-5-3-6-17(9-15)21(25)12-16-10-18(22)13-20(11-16)24(2)19-7-4-8-23-14-19/h3-11,13-14H,12H2,1-2H3 |
| InChIKey | SUYGNCTYWKVQPY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |